C17H16N4O3S — CID 16952466
1,5-dimethyl-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)pyrazole-3-carboxamide (PubChem CID 16952466) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is 1,5-dimethyl-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)pyrazole-3-carboxamide.
| Compound Name | 1,5-dimethyl-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 16952466 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 1,5-dimethyl-N-(7-prop-2-enyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)pyrazole-3-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc(C)n(C)n2)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C17H16N4O3S/c1-4-5-21-12-7-13-14(24-9-23-13)8-15(12)25-17(21)18-16(22)11-6-10(2)20(3)19-11/h4,6-8H,1,5,9H2,2-3H3/b18-17- |
| InChIKey | UKURUKNGQUWIMS-ZCXUNETKSA-N |
| XLogP | 2.40 |
| TPSA | 70.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|