C24H26FN3O3S2 — CID 16924501
1-(4-fluorophenyl)sulfonyl-N-(6-propan-2-yl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)pyrrolidine-2-carboxamide (PubChem CID 16924501) has the molecular formula C24H26FN3O3S2 and a molecular weight of 487.62 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N-(6-propan-2-yl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N-(6-propan-2-yl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 16924501 |
| Molecular Formula | C24H26FN3O3S2 |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N-(6-propan-2-yl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)pyrrolidine-2-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)C2CCCN2S(=O)(=O)c2ccc(F)cc2)sc2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C24H26FN3O3S2/c1-4-13-27-20-12-7-17(16(2)3)15-22(20)32-24(27)26-23(29)21-6-5-14-28(21)33(30,31)19-10-8-18(25)9-11-19/h4,7-12,15-16,21H,1,5-6,13-14H2,2-3H3/b26-24- |
| InChIKey | UKUUEEUARVVECQ-LCUIJRPUSA-N |
| XLogP | 4.43 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|