C23H27N3O3S3 — CID 41019455
N-(6-propan-2-yl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 41019455) has the molecular formula C23H27N3O3S3 and a molecular weight of 489.69 g/mol. Its IUPAC name is N-(6-propan-2-yl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(6-propan-2-yl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 41019455 |
| Molecular Formula | C23H27N3O3S3 |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | N-(6-propan-2-yl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)C2CCN(S(=O)(=O)c3cccs3)CC2)sc2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C23H27N3O3S3/c1-4-11-26-19-8-7-18(16(2)3)15-20(19)31-23(26)24-22(27)17-9-12-25(13-10-17)32(28,29)21-6-5-14-30-21/h4-8,14-17H,1,9-13H2,2-3H3/b24-23- |
| InChIKey | ILNOUGSJMXIOPE-VHXPQNKSSA-N |
| XLogP | 4.60 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|