C22H25N3O3S3 — CID 41019463
N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 41019463) has the molecular formula C22H25N3O3S3 and a molecular weight of 475.66 g/mol. Its IUPAC name is N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 41019463 |
| Molecular Formula | C22H25N3O3S3 |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)C2CCN(S(=O)(=O)c3cccs3)CC2)sc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C22H25N3O3S3/c1-4-9-25-18-13-15(2)16(3)14-19(18)30-22(25)23-21(26)17-7-10-24(11-8-17)31(27,28)20-6-5-12-29-20/h4-6,12-14,17H,1,7-11H2,2-3H3/b23-22- |
| InChIKey | STBIXOHWYLCIBV-FCQUAONHSA-N |
| XLogP | 4.10 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|