C21H21FN4O5S3 — CID 16924542
1-(4-fluorophenyl)sulfonyl-N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]pyrrolidine-2-carboxamide (PubChem CID 16924542) has the molecular formula C21H21FN4O5S3 and a molecular weight of 524.62 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 16924542 |
| Molecular Formula | C21H21FN4O5S3 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]pyrrolidine-2-carboxamide |
| SMILES | CSCCn1/c(=N/C(=O)C2CCCN2S(=O)(=O)c2ccc(F)cc2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C21H21FN4O5S3/c1-32-12-11-24-17-9-6-15(26(28)29)13-19(17)33-21(24)23-20(27)18-3-2-10-25(18)34(30,31)16-7-4-14(22)5-8-16/h4-9,13,18H,2-3,10-12H2,1H3/b23-21- |
| InChIKey | CBSAYXOKWWPNLO-LNVKXUELSA-N |
| XLogP | 3.39 |
| TPSA | 114.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|