C18H16ClN3O5S3 — CID 41125261
2-(4-chlorophenyl)sulfonyl-N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]acetamide (PubChem CID 41125261) has the molecular formula C18H16ClN3O5S3 and a molecular weight of 486.00 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]acetamide |
|---|---|
| PubChem CID | 41125261 |
| Molecular Formula | C18H16ClN3O5S3 |
| Molecular Weight | 486.00 g/mol |
| Exact Mass | 484.99 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]acetamide |
| SMILES | CSCCn1/c(=N/C(=O)CS(=O)(=O)c2ccc(Cl)cc2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C18H16ClN3O5S3/c1-28-9-8-21-15-7-4-13(22(24)25)10-16(15)29-18(21)20-17(23)11-30(26,27)14-5-2-12(19)3-6-14/h2-7,10H,8-9,11H2,1H3/b20-18- |
| InChIKey | UHYVWVZKWLCOMY-ZZEZOPTASA-N |
| XLogP | 3.53 |
| TPSA | 111.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.00 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|