C22H23FN4O6S2 — CID 42523227
1-(4-fluorophenyl)sulfonyl-N-[3-(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]piperidine-4-carboxamide (PubChem CID 42523227) has the molecular formula C22H23FN4O6S2 and a molecular weight of 522.58 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N-[3-(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]piperidine-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N-[3-(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42523227 |
| Molecular Formula | C22H23FN4O6S2 |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N-[3-(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]piperidine-4-carboxamide |
| SMILES | COCCn1/c(=N/C(=O)C2CCN(S(=O)(=O)c3ccc(F)cc3)CC2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C22H23FN4O6S2/c1-33-13-12-26-19-7-4-17(27(29)30)14-20(19)34-22(26)24-21(28)15-8-10-25(11-9-15)35(31,32)18-5-2-16(23)3-6-18/h2-7,14-15H,8-13H2,1H3/b24-22- |
| InChIKey | HBJFXTIQUSPLIC-GYHWCHFESA-N |
| XLogP | 2.92 |
| TPSA | 124.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|