C22H22N4O8S2 — CID 16924614
methyl 2-[2-[1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carbonyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate (PubChem CID 16924614) has the molecular formula C22H22N4O8S2 and a molecular weight of 534.57 g/mol. Its IUPAC name is methyl 2-[2-[1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carbonyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-[1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carbonyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 16924614 |
| Molecular Formula | C22H22N4O8S2 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | methyl 2-[2-[1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carbonyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)C2CCCN2S(=O)(=O)c2ccc(OC)cc2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C22H22N4O8S2/c1-33-15-6-8-16(9-7-15)36(31,32)25-11-3-4-18(25)21(28)23-22-24(13-20(27)34-2)17-10-5-14(26(29)30)12-19(17)35-22/h5-10,12,18H,3-4,11,13H2,1-2H3/b23-22- |
| InChIKey | AEYUWDKLUFDPLV-FCQUAONHSA-N |
| XLogP | 2.07 |
| TPSA | 150.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|