C20H18F2N2O4S2 — CID 41324221
N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-(4-methoxyphenyl)sulfonylpropanamide (PubChem CID 41324221) has the molecular formula C20H18F2N2O4S2 and a molecular weight of 452.50 g/mol. Its IUPAC name is N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-(4-methoxyphenyl)sulfonylpropanamide.
| Compound Name | N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-(4-methoxyphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 41324221 |
| Molecular Formula | C20H18F2N2O4S2 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-(4-methoxyphenyl)sulfonylpropanamide |
| SMILES | C=CCn1/c(=N/C(=O)CCS(=O)(=O)c2ccc(OC)cc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C20H18F2N2O4S2/c1-3-9-24-19-16(22)11-13(21)12-17(19)29-20(24)23-18(25)8-10-30(26,27)15-6-4-14(28-2)5-7-15/h3-7,11-12H,1,8-10H2,2H3/b23-20- |
| InChIKey | DYJPPLCEZFFAPK-ATJXCDBQSA-N |
| XLogP | 3.47 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|