C19H15N3O3S2 — CID 74728951
N-(4,6-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-(5-nitrothiophen-2-yl)prop-2-enamide (PubChem CID 74728951) has the molecular formula C19H15N3O3S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-(4,6-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-(5-nitrothiophen-2-yl)prop-2-enamide.
| Compound Name | N-(4,6-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-(5-nitrothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 74728951 |
| Molecular Formula | C19H15N3O3S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | N-(4,6-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-(5-nitrothiophen-2-yl)prop-2-enamide |
| SMILES | C#CCn1/c(=N/C(=O)C=Cc2ccc([N+](=O)[O-])s2)sc2cc(C)cc(C)c21 |
| InChI | InChI=1S/C19H15N3O3S2/c1-4-9-21-18-13(3)10-12(2)11-15(18)27-19(21)20-16(23)7-5-14-6-8-17(26-14)22(24)25/h1,5-8,10-11H,9H2,2-3H3/b7-5?,20-19- |
| InChIKey | SJDUXCLBERNKAI-QOHQZYBDSA-N |
| XLogP | 4.06 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|