C21H20N2O6S2 — CID 43938060
(Z)-3-(1,3-benzodioxol-5-yl)-N-[3-(2-methoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]prop-2-enamide (PubChem CID 43938060) has the molecular formula C21H20N2O6S2 and a molecular weight of 460.53 g/mol. Its IUPAC name is (Z)-3-(1,3-benzodioxol-5-yl)-N-[3-(2-methoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]prop-2-enamide.
| Compound Name | (Z)-3-(1,3-benzodioxol-5-yl)-N-[3-(2-methoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]prop-2-enamide |
|---|---|
| PubChem CID | 43938060 |
| Molecular Formula | C21H20N2O6S2 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | (Z)-3-(1,3-benzodioxol-5-yl)-N-[3-(2-methoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]prop-2-enamide |
| SMILES | COCCn1/c(=N/C(=O)/C=C\c2ccc3c(c2)OCO3)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C21H20N2O6S2/c1-27-10-9-23-16-6-5-15(31(2,25)26)12-19(16)30-21(23)22-20(24)8-4-14-3-7-17-18(11-14)29-13-28-17/h3-8,11-12H,9-10,13H2,1-2H3/b8-4-,22-21- |
| InChIKey | JSDHZQLGDMULRE-BJMKQINJSA-N |
| XLogP | 2.62 |
| TPSA | 96.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|