C22H20N2O7S2 — CID 43940607
ethyl 2-[2-[(Z)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]imino-6-methylsulfonyl-1,3-benzothiazol-3-yl]acetate (PubChem CID 43940607) has the molecular formula C22H20N2O7S2 and a molecular weight of 488.54 g/mol. Its IUPAC name is ethyl 2-[2-[(Z)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]imino-6-methylsulfonyl-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-[(Z)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]imino-6-methylsulfonyl-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 43940607 |
| Molecular Formula | C22H20N2O7S2 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | ethyl 2-[2-[(Z)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]imino-6-methylsulfonyl-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)/C=C\c2ccc3c(c2)OCO3)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C22H20N2O7S2/c1-3-29-21(26)12-24-16-7-6-15(33(2,27)28)11-19(16)32-22(24)23-20(25)9-5-14-4-8-17-18(10-14)31-13-30-17/h4-11H,3,12-13H2,1-2H3/b9-5-,23-22- |
| InChIKey | IAPPHSGEBHIYKB-IOCQUDQHSA-N |
| XLogP | 2.54 |
| TPSA | 113.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|