C18H19N3O7S2 — CID 4258450
ethyl 2-[2-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]imino-6-methylsulfonyl-1,3-benzothiazol-3-yl]acetate (PubChem CID 4258450) has the molecular formula C18H19N3O7S2 and a molecular weight of 453.50 g/mol. Its IUPAC name is ethyl 2-[2-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]imino-6-methylsulfonyl-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]imino-6-methylsulfonyl-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4258450 |
| Molecular Formula | C18H19N3O7S2 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | ethyl 2-[2-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]imino-6-methylsulfonyl-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)CN2C(=O)CCC2=O)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C18H19N3O7S2/c1-3-28-17(25)10-20-12-5-4-11(30(2,26)27)8-13(12)29-18(20)19-14(22)9-21-15(23)6-7-16(21)24/h4-5,8H,3,6-7,9-10H2,1-2H3/b19-18- |
| InChIKey | BTRBTZAPLCGCGZ-HNENSFHCSA-N |
| XLogP | 0.25 |
| TPSA | 132.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|