C19H25N3O5S2 — CID 43940528
ethyl 2-[2-(2-cyclohexylacetyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate (PubChem CID 43940528) has the molecular formula C19H25N3O5S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is ethyl 2-[2-(2-cyclohexylacetyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-(2-cyclohexylacetyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 43940528 |
| Molecular Formula | C19H25N3O5S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | ethyl 2-[2-(2-cyclohexylacetyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)CC2CCCCC2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C19H25N3O5S2/c1-2-27-18(24)12-22-15-9-8-14(29(20,25)26)11-16(15)28-19(22)21-17(23)10-13-6-4-3-5-7-13/h8-9,11,13H,2-7,10,12H2,1H3,(H2,20,25,26)/b21-19- |
| InChIKey | NBYCVLDZJFKXDG-VZCXRCSSSA-N |
| XLogP | 2.31 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |