C23H21N3O5S2 — CID 16849579
ethyl 2-[2-(2-naphthalen-2-ylacetyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate (PubChem CID 16849579) has the molecular formula C23H21N3O5S2 and a molecular weight of 483.57 g/mol. Its IUPAC name is ethyl 2-[2-(2-naphthalen-2-ylacetyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-(2-naphthalen-2-ylacetyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 16849579 |
| Molecular Formula | C23H21N3O5S2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | ethyl 2-[2-(2-naphthalen-2-ylacetyl)imino-6-sulfamoyl-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)Cc2ccc3ccccc3c2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C23H21N3O5S2/c1-2-31-22(28)14-26-19-10-9-18(33(24,29)30)13-20(19)32-23(26)25-21(27)12-15-7-8-16-5-3-4-6-17(16)11-15/h3-11,13H,2,12,14H2,1H3,(H2,24,29,30)/b25-23- |
| InChIKey | VCKAHUUSKUVDDO-BZZOAKBMSA-N |
| XLogP | 2.74 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |