C21H16N2O3S — CID 43944930
(Z)-3-(1,3-benzodioxol-5-yl)-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)prop-2-enamide (PubChem CID 43944930) has the molecular formula C21H16N2O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is (Z)-3-(1,3-benzodioxol-5-yl)-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)prop-2-enamide.
| Compound Name | (Z)-3-(1,3-benzodioxol-5-yl)-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)prop-2-enamide |
|---|---|
| PubChem CID | 43944930 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (Z)-3-(1,3-benzodioxol-5-yl)-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)prop-2-enamide |
| SMILES | C#CCn1/c(=N/C(=O)/C=C\c2ccc3c(c2)OCO3)sc2cc(C)ccc21 |
| InChI | InChI=1S/C21H16N2O3S/c1-3-10-23-16-7-4-14(2)11-19(16)27-21(23)22-20(24)9-6-15-5-8-17-18(12-15)26-13-25-17/h1,4-9,11-12H,10,13H2,2H3/b9-6-,22-21- |
| InChIKey | YHUJBKIEFQJIIZ-WNNBTJOOSA-N |
| XLogP | 3.51 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|