C22H18N2O5S — CID 43945602
(Z)-3-(1,3-benzodioxol-5-yl)-N-(4,7-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)prop-2-enamide (PubChem CID 43945602) has the molecular formula C22H18N2O5S and a molecular weight of 422.46 g/mol. Its IUPAC name is (Z)-3-(1,3-benzodioxol-5-yl)-N-(4,7-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)prop-2-enamide.
| Compound Name | (Z)-3-(1,3-benzodioxol-5-yl)-N-(4,7-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)prop-2-enamide |
|---|---|
| PubChem CID | 43945602 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | (Z)-3-(1,3-benzodioxol-5-yl)-N-(4,7-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)prop-2-enamide |
| SMILES | C#CCn1/c(=N/C(=O)/C=C\c2ccc3c(c2)OCO3)sc2c(OC)ccc(OC)c21 |
| InChI | InChI=1S/C22H18N2O5S/c1-4-11-24-20-16(26-2)8-9-17(27-3)21(20)30-22(24)23-19(25)10-6-14-5-7-15-18(12-14)29-13-28-15/h1,5-10,12H,11,13H2,2-3H3/b10-6-,23-22- |
| InChIKey | LWVUAIITPQUKJM-BHNGKPIPSA-N |
| XLogP | 3.22 |
| TPSA | 71.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|