C14H16N2O4S — CID 7153575
methyl 2-(2-acetylimino-4-ethoxy-1,3-benzothiazol-3-yl)acetate (PubChem CID 7153575) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is methyl 2-(2-acetylimino-4-ethoxy-1,3-benzothiazol-3-yl)acetate.
| Compound Name | methyl 2-(2-acetylimino-4-ethoxy-1,3-benzothiazol-3-yl)acetate |
|---|---|
| PubChem CID | 7153575 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | methyl 2-(2-acetylimino-4-ethoxy-1,3-benzothiazol-3-yl)acetate |
| SMILES | CCOc1cccc2s/c(=N\C(C)=O)n(CC(=O)OC)c12 |
| InChI | InChI=1S/C14H16N2O4S/c1-4-20-10-6-5-7-11-13(10)16(8-12(18)19-3)14(21-11)15-9(2)17/h5-7H,4,8H2,1-3H3/b15-14- |
| InChIKey | NNQZGIBAIFMJBW-PFONDFGASA-N |
| XLogP | 1.72 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |