C20H19IN2O4S — CID 41204347
ethyl 2-[4-ethoxy-2-(2-iodobenzoyl)imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 41204347) has the molecular formula C20H19IN2O4S and a molecular weight of 510.35 g/mol. Its IUPAC name is ethyl 2-[4-ethoxy-2-(2-iodobenzoyl)imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[4-ethoxy-2-(2-iodobenzoyl)imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 41204347 |
| Molecular Formula | C20H19IN2O4S |
| Molecular Weight | 510.35 g/mol |
| Exact Mass | 510.01 |
| IUPAC Name | ethyl 2-[4-ethoxy-2-(2-iodobenzoyl)imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2ccccc2I)sc2cccc(OCC)c21 |
| InChI | InChI=1S/C20H19IN2O4S/c1-3-26-15-10-7-11-16-18(15)23(12-17(24)27-4-2)20(28-16)22-19(25)13-8-5-6-9-14(13)21/h5-11H,3-4,12H2,1-2H3/b22-20- |
| InChIKey | YVFPUDLRSWTBIE-XDOYNYLZSA-N |
| XLogP | 4.01 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|