C21H20Cl2N2O4S — CID 43941998
methyl 2-[2-(4-butoxybenzoyl)imino-4,6-dichloro-1,3-benzothiazol-3-yl]acetate (PubChem CID 43941998) has the molecular formula C21H20Cl2N2O4S and a molecular weight of 467.37 g/mol. Its IUPAC name is methyl 2-[2-(4-butoxybenzoyl)imino-4,6-dichloro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-(4-butoxybenzoyl)imino-4,6-dichloro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 43941998 |
| Molecular Formula | C21H20Cl2N2O4S |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | methyl 2-[2-(4-butoxybenzoyl)imino-4,6-dichloro-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCCCOc1ccc(C(=O)/N=c2\sc3cc(Cl)cc(Cl)c3n2CC(=O)OC)cc1 |
| InChI | InChI=1S/C21H20Cl2N2O4S/c1-3-4-9-29-15-7-5-13(6-8-15)20(27)24-21-25(12-18(26)28-2)19-16(23)10-14(22)11-17(19)30-21/h5-8,10-11H,3-4,9,12H2,1-2H3/b24-21- |
| InChIKey | FJQRFHOURCQVLH-FLFQWRMESA-N |
| XLogP | 5.10 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|