C23H25ClN2O4S — CID 43942142
methyl 2-[5-chloro-4-methyl-2-(4-pentoxybenzoyl)imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 43942142) has the molecular formula C23H25ClN2O4S and a molecular weight of 460.98 g/mol. Its IUPAC name is methyl 2-[5-chloro-4-methyl-2-(4-pentoxybenzoyl)imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[5-chloro-4-methyl-2-(4-pentoxybenzoyl)imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 43942142 |
| Molecular Formula | C23H25ClN2O4S |
| Molecular Weight | 460.98 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | methyl 2-[5-chloro-4-methyl-2-(4-pentoxybenzoyl)imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCCCCOc1ccc(C(=O)/N=c2\sc3ccc(Cl)c(C)c3n2CC(=O)OC)cc1 |
| InChI | InChI=1S/C23H25ClN2O4S/c1-4-5-6-13-30-17-9-7-16(8-10-17)22(28)25-23-26(14-20(27)29-3)21-15(2)18(24)11-12-19(21)31-23/h7-12H,4-6,13-14H2,1-3H3/b25-23- |
| InChIKey | IZPAAWPPXHHBMR-BZZOAKBMSA-N |
| XLogP | 5.15 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.98 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|