C23H28N2O4S — CID 40888297
N-[4-methoxy-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-pentoxybenzamide (PubChem CID 40888297) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is N-[4-methoxy-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-pentoxybenzamide.
| Compound Name | N-[4-methoxy-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 40888297 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[4-methoxy-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)/N=c2\sc3cccc(OC)c3n2CCOC)cc1 |
| InChI | InChI=1S/C23H28N2O4S/c1-4-5-6-15-29-18-12-10-17(11-13-18)22(26)24-23-25(14-16-27-2)21-19(28-3)8-7-9-20(21)30-23/h7-13H,4-6,14-16H2,1-3H3/b24-23- |
| InChIKey | XAJUVWDJNUYIFL-VHXPQNKSSA-N |
| XLogP | 4.67 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|