C22H24F2N2O3S — CID 3682908
N-[4,6-difluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-pentoxybenzamide (PubChem CID 3682908) has the molecular formula C22H24F2N2O3S and a molecular weight of 434.51 g/mol. Its IUPAC name is N-[4,6-difluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-pentoxybenzamide.
| Compound Name | N-[4,6-difluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 3682908 |
| Molecular Formula | C22H24F2N2O3S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | N-[4,6-difluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)/N=c2\sc3cc(F)cc(F)c3n2CCOC)cc1 |
| InChI | InChI=1S/C22H24F2N2O3S/c1-3-4-5-11-29-17-8-6-15(7-9-17)21(27)25-22-26(10-12-28-2)20-18(24)13-16(23)14-19(20)30-22/h6-9,13-14H,3-5,10-12H2,1-2H3/b25-22- |
| InChIKey | SVPZXBASYZAVSW-LVWGJNHUSA-N |
| XLogP | 4.94 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|