C22H16N2O3S — CID 43946229
N-(4,6-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-oxochromene-3-carboxamide (PubChem CID 43946229) has the molecular formula C22H16N2O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-(4,6-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-oxochromene-3-carboxamide.
| Compound Name | N-(4,6-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 43946229 |
| Molecular Formula | C22H16N2O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-(4,6-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-oxochromene-3-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cc3ccccc3oc2=O)sc2cc(C)cc(C)c21 |
| InChI | InChI=1S/C22H16N2O3S/c1-4-9-24-19-14(3)10-13(2)11-18(19)28-22(24)23-20(25)16-12-15-7-5-6-8-17(15)27-21(16)26/h1,5-8,10-12H,9H2,2-3H3/b23-22- |
| InChIKey | WWTSKRLGIOLNOQ-FCQUAONHSA-N |
| XLogP | 3.80 |
| TPSA | 64.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|