C22H20N2O4S — CID 43984493
N-(6-ethoxy-3-propyl-1,3-benzothiazol-2-ylidene)-2-oxochromene-3-carboxamide (PubChem CID 43984493) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is N-(6-ethoxy-3-propyl-1,3-benzothiazol-2-ylidene)-2-oxochromene-3-carboxamide.
| Compound Name | N-(6-ethoxy-3-propyl-1,3-benzothiazol-2-ylidene)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 43984493 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-(6-ethoxy-3-propyl-1,3-benzothiazol-2-ylidene)-2-oxochromene-3-carboxamide |
| SMILES | CCCn1/c(=N/C(=O)c2cc3ccccc3oc2=O)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C22H20N2O4S/c1-3-11-24-17-10-9-15(27-4-2)13-19(17)29-22(24)23-20(25)16-12-14-7-5-6-8-18(14)28-21(16)26/h5-10,12-13H,3-4,11H2,1-2H3/b23-22- |
| InChIKey | QXGKSCDGEBUZJT-FCQUAONHSA-N |
| XLogP | 4.36 |
| TPSA | 73.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|