C21H17FN2O4S — CID 4625675
N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-2-oxochromene-3-carboxamide (PubChem CID 4625675) has the molecular formula C21H17FN2O4S and a molecular weight of 412.44 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-2-oxochromene-3-carboxamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 4625675 |
| Molecular Formula | C21H17FN2O4S |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-2-oxochromene-3-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc3ccccc3oc2=O)sc2cc(F)ccc21 |
| InChI | InChI=1S/C21H17FN2O4S/c1-2-27-10-9-24-16-8-7-14(22)12-18(16)29-21(24)23-19(25)15-11-13-5-3-4-6-17(13)28-20(15)26/h3-8,11-12H,2,9-10H2,1H3/b23-21- |
| InChIKey | XOKNFEQZABEUIS-LNVKXUELSA-N |
| XLogP | 3.73 |
| TPSA | 73.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|