C20H22FN3O2S — CID 4685853
4-(dimethylamino)-N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 4685853) has the molecular formula C20H22FN3O2S and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-(dimethylamino)-N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 4685853 |
| Molecular Formula | C20H22FN3O2S |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 4-(dimethylamino)-N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(N(C)C)cc2)sc2cc(F)ccc21 |
| InChI | InChI=1S/C20H22FN3O2S/c1-4-26-12-11-24-17-10-7-15(21)13-18(17)27-20(24)22-19(25)14-5-8-16(9-6-14)23(2)3/h5-10,13H,4,11-12H2,1-3H3/b22-20- |
| InChIKey | VSBJOBJAVLQICA-XDOYNYLZSA-N |
| XLogP | 3.69 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|