C16H21FN2O2S — CID 43937452
N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-3-methylbutanamide (PubChem CID 43937452) has the molecular formula C16H21FN2O2S and a molecular weight of 324.42 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-3-methylbutanamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-3-methylbutanamide |
|---|---|
| PubChem CID | 43937452 |
| Molecular Formula | C16H21FN2O2S |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-3-methylbutanamide |
| SMILES | CCOCCn1/c(=N/C(=O)CC(C)C)sc2cc(F)ccc21 |
| InChI | InChI=1S/C16H21FN2O2S/c1-4-21-8-7-19-13-6-5-12(17)10-14(13)22-16(19)18-15(20)9-11(2)3/h5-6,10-11H,4,7-9H2,1-3H3/b18-16- |
| InChIKey | MSABLYPXFGXXSV-VLGSPTGOSA-N |
| XLogP | 3.35 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|