C25H21FN2O3S — CID 43937479
N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-9H-xanthene-9-carboxamide (PubChem CID 43937479) has the molecular formula C25H21FN2O3S and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-9H-xanthene-9-carboxamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 43937479 |
| Molecular Formula | C25H21FN2O3S |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-9H-xanthene-9-carboxamide |
| SMILES | CCOCCn1/c(=N\C(=O)C2c3ccccc3Oc3ccccc32)sc2cc(F)ccc21 |
| InChI | InChI=1S/C25H21FN2O3S/c1-2-30-14-13-28-19-12-11-16(26)15-22(19)32-25(28)27-24(29)23-17-7-3-5-9-20(17)31-21-10-6-4-8-18(21)23/h3-12,15,23H,2,13-14H2,1H3/b27-25+ |
| InChIKey | SPOMXBMKCNWXKT-IMVLJIQESA-N |
| XLogP | 5.24 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|