C15H17FN2O3S2 — CID 4096504
S-[2-[[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]amino]-2-oxoethyl] ethanethioate (PubChem CID 4096504) has the molecular formula C15H17FN2O3S2 and a molecular weight of 356.44 g/mol. Its IUPAC name is S-[2-[[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]amino]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]amino]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 4096504 |
| Molecular Formula | C15H17FN2O3S2 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | S-[2-[[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]amino]-2-oxoethyl] ethanethioate |
| SMILES | CCOCCn1/c(=N/C(=O)CSC(C)=O)sc2cc(F)ccc21 |
| InChI | InChI=1S/C15H17FN2O3S2/c1-3-21-7-6-18-12-5-4-11(16)8-13(12)23-15(18)17-14(20)9-22-10(2)19/h4-5,8H,3,6-7,9H2,1-2H3/b17-15- |
| InChIKey | IUWPNNJVAJFLJO-ICFOKQHNSA-N |
| XLogP | 2.59 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|