C14H15FN2O3S2 — CID 3244663
S-[2-[[6-fluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]amino]-2-oxoethyl] ethanethioate (PubChem CID 3244663) has the molecular formula C14H15FN2O3S2 and a molecular weight of 342.42 g/mol. Its IUPAC name is S-[2-[[6-fluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]amino]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[[6-fluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]amino]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 3244663 |
| Molecular Formula | C14H15FN2O3S2 |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | S-[2-[[6-fluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]amino]-2-oxoethyl] ethanethioate |
| SMILES | COCCn1/c(=N/C(=O)CSC(C)=O)sc2cc(F)ccc21 |
| InChI | InChI=1S/C14H15FN2O3S2/c1-9(18)21-8-13(19)16-14-17(5-6-20-2)11-4-3-10(15)7-12(11)22-14/h3-4,7H,5-6,8H2,1-2H3/b16-14- |
| InChIKey | OHUXDMQVIFMYNE-PEZBUJJGSA-N |
| XLogP | 2.20 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|