C14H14N2O4S2 — CID 3426440
methyl 2-(2-acetylsulfanylacetyl)imino-3-methyl-1,3-benzothiazole-6-carboxylate (PubChem CID 3426440) has the molecular formula C14H14N2O4S2 and a molecular weight of 338.41 g/mol. Its IUPAC name is methyl 2-(2-acetylsulfanylacetyl)imino-3-methyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-(2-acetylsulfanylacetyl)imino-3-methyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 3426440 |
| Molecular Formula | C14H14N2O4S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | methyl 2-(2-acetylsulfanylacetyl)imino-3-methyl-1,3-benzothiazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)s/c(=N\C(=O)CSC(C)=O)n2C |
| InChI | InChI=1S/C14H14N2O4S2/c1-8(17)21-7-12(18)15-14-16(2)10-5-4-9(13(19)20-3)6-11(10)22-14/h4-6H,7H2,1-3H3/b15-14- |
| InChIKey | XLDDFOFEVHFGTR-PFONDFGASA-N |
| XLogP | 1.73 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|