C15H16N2O4S3 — CID 16949396
methyl 2-[2-(2-acetylsulfanylacetyl)imino-6-methylsulfanyl-1,3-benzothiazol-3-yl]acetate (PubChem CID 16949396) has the molecular formula C15H16N2O4S3 and a molecular weight of 384.50 g/mol. Its IUPAC name is methyl 2-[2-(2-acetylsulfanylacetyl)imino-6-methylsulfanyl-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-(2-acetylsulfanylacetyl)imino-6-methylsulfanyl-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 16949396 |
| Molecular Formula | C15H16N2O4S3 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | methyl 2-[2-(2-acetylsulfanylacetyl)imino-6-methylsulfanyl-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)CSC(C)=O)sc2cc(SC)ccc21 |
| InChI | InChI=1S/C15H16N2O4S3/c1-9(18)23-8-13(19)16-15-17(7-14(20)21-2)11-5-4-10(22-3)6-12(11)24-15/h4-6H,7-8H2,1-3H3/b16-15- |
| InChIKey | PJBLJWWXJORBES-NXVVXOECSA-N |
| XLogP | 2.30 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|