C15H14N2O2S3 — CID 16949398
S-[2-[(6-methylsulfanyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl] ethanethioate (PubChem CID 16949398) has the molecular formula C15H14N2O2S3 and a molecular weight of 350.49 g/mol. Its IUPAC name is S-[2-[(6-methylsulfanyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[(6-methylsulfanyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 16949398 |
| Molecular Formula | C15H14N2O2S3 |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | S-[2-[(6-methylsulfanyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl] ethanethioate |
| SMILES | C#CCn1/c(=N/C(=O)CSC(C)=O)sc2cc(SC)ccc21 |
| InChI | InChI=1S/C15H14N2O2S3/c1-4-7-17-12-6-5-11(20-3)8-13(12)22-15(17)16-14(19)9-21-10(2)18/h1,5-6,8H,7,9H2,2-3H3/b16-15- |
| InChIKey | KFRQTFOOIIVHFL-NXVVXOECSA-N |
| XLogP | 2.76 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|