C21H20N2O2S3 — CID 41325624
3-(4-methoxyphenyl)sulfanyl-N-(6-methylsulfanyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)propanamide (PubChem CID 41325624) has the molecular formula C21H20N2O2S3 and a molecular weight of 428.60 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)sulfanyl-N-(6-methylsulfanyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)propanamide.
| Compound Name | 3-(4-methoxyphenyl)sulfanyl-N-(6-methylsulfanyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)propanamide |
|---|---|
| PubChem CID | 41325624 |
| Molecular Formula | C21H20N2O2S3 |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 3-(4-methoxyphenyl)sulfanyl-N-(6-methylsulfanyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)propanamide |
| SMILES | C#CCn1/c(=N/C(=O)CCSc2ccc(OC)cc2)sc2cc(SC)ccc21 |
| InChI | InChI=1S/C21H20N2O2S3/c1-4-12-23-18-10-9-17(26-3)14-19(18)28-21(23)22-20(24)11-13-27-16-7-5-15(25-2)6-8-16/h1,5-10,14H,11-13H2,2-3H3/b22-21- |
| InChIKey | DYQTXWCTTAVKDA-DQRAZIAOSA-N |
| XLogP | 4.68 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|