C22H22N2O3S2 — CID 41085959
N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-phenylsulfanylbutanamide (PubChem CID 41085959) has the molecular formula C22H22N2O3S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-phenylsulfanylbutanamide.
| Compound Name | N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 41085959 |
| Molecular Formula | C22H22N2O3S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-phenylsulfanylbutanamide |
| SMILES | C#CCn1/c(=N/C(=O)CCCSc2ccccc2)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C22H22N2O3S2/c1-4-12-24-17-14-18(26-2)19(27-3)15-20(17)29-22(24)23-21(25)11-8-13-28-16-9-6-5-7-10-16/h1,5-7,9-10,14-15H,8,11-13H2,2-3H3/b23-22- |
| InChIKey | WNLMSZRAPRASPW-FCQUAONHSA-N |
| XLogP | 4.35 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|