C21H22N2O3S2 — CID 40694778
N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-phenylsulfanylpropanamide (PubChem CID 40694778) has the molecular formula C21H22N2O3S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-phenylsulfanylpropanamide.
| Compound Name | N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 40694778 |
| Molecular Formula | C21H22N2O3S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-phenylsulfanylpropanamide |
| SMILES | C=CCn1/c(=N/C(=O)CCSc2ccccc2)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C21H22N2O3S2/c1-4-11-23-16-13-17(25-2)18(26-3)14-19(16)28-21(23)22-20(24)10-12-27-15-8-6-5-7-9-15/h4-9,13-14H,1,10-12H2,2-3H3/b22-21- |
| InChIKey | BTAAEIILLVLCDB-DQRAZIAOSA-N |
| XLogP | 4.52 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|