C26H22N2O4S — CID 43979595
N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-9H-xanthene-9-carboxamide (PubChem CID 43979595) has the molecular formula C26H22N2O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-9H-xanthene-9-carboxamide.
| Compound Name | N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 43979595 |
| Molecular Formula | C26H22N2O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-9H-xanthene-9-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)C2c3ccccc3Oc3ccccc32)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C26H22N2O4S/c1-4-13-28-18-14-21(30-2)22(31-3)15-23(18)33-26(28)27-25(29)24-16-9-5-7-11-19(16)32-20-12-8-6-10-17(20)24/h4-12,14-15,24H,1,13H2,2-3H3/b27-26- |
| InChIKey | GLKGGGGBMZFMDX-RQZHXJHFSA-N |
| XLogP | 5.27 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|