C26H20N2O4S — CID 43942617
methyl 3-prop-2-enyl-2-(9H-xanthene-9-carbonylimino)-1,3-benzothiazole-6-carboxylate (PubChem CID 43942617) has the molecular formula C26H20N2O4S and a molecular weight of 456.52 g/mol. Its IUPAC name is methyl 3-prop-2-enyl-2-(9H-xanthene-9-carbonylimino)-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 3-prop-2-enyl-2-(9H-xanthene-9-carbonylimino)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 43942617 |
| Molecular Formula | C26H20N2O4S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | methyl 3-prop-2-enyl-2-(9H-xanthene-9-carbonylimino)-1,3-benzothiazole-6-carboxylate |
| SMILES | C=CCn1/c(=N\C(=O)C2c3ccccc3Oc3ccccc32)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C26H20N2O4S/c1-3-14-28-19-13-12-16(25(30)31-2)15-22(19)33-26(28)27-24(29)23-17-8-4-6-10-20(17)32-21-11-7-5-9-18(21)23/h3-13,15,23H,1,14H2,2H3/b27-26+ |
| InChIKey | GUIZLTMZCFEDEO-CYYJNZCTSA-N |
| XLogP | 5.04 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|