C26H20N2O4S — CID 43945499
N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-9H-xanthene-9-carboxamide (PubChem CID 43945499) has the molecular formula C26H20N2O4S and a molecular weight of 456.52 g/mol. Its IUPAC name is N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-9H-xanthene-9-carboxamide.
| Compound Name | N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 43945499 |
| Molecular Formula | C26H20N2O4S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-9H-xanthene-9-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)C2c3ccccc3Oc3ccccc32)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C26H20N2O4S/c1-4-13-28-18-14-21(30-2)22(31-3)15-23(18)33-26(28)27-25(29)24-16-9-5-7-11-19(16)32-20-12-8-6-10-17(20)24/h1,5-12,14-15,24H,13H2,2-3H3/b27-26- |
| InChIKey | WBHFZLIBORFHRT-RQZHXJHFSA-N |
| XLogP | 4.72 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|