C22H22N2O4S3 — CID 41087465
4-(4-methoxyphenyl)sulfonyl-N-(6-methylsulfanyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)butanamide (PubChem CID 41087465) has the molecular formula C22H22N2O4S3 and a molecular weight of 474.63 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfonyl-N-(6-methylsulfanyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)butanamide.
| Compound Name | 4-(4-methoxyphenyl)sulfonyl-N-(6-methylsulfanyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)butanamide |
|---|---|
| PubChem CID | 41087465 |
| Molecular Formula | C22H22N2O4S3 |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfonyl-N-(6-methylsulfanyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)butanamide |
| SMILES | C#CCn1/c(=N/C(=O)CCCS(=O)(=O)c2ccc(OC)cc2)sc2cc(SC)ccc21 |
| InChI | InChI=1S/C22H22N2O4S3/c1-4-13-24-19-12-9-17(29-3)15-20(19)30-22(24)23-21(25)6-5-14-31(26,27)18-10-7-16(28-2)8-11-18/h1,7-12,15H,5-6,13-14H2,2-3H3/b23-22- |
| InChIKey | FSGASGUQBJEVRK-FCQUAONHSA-N |
| XLogP | 3.75 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|