C21H20N2O4S2 — CID 41324224
3-(4-methoxyphenyl)sulfonyl-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)propanamide (PubChem CID 41324224) has the molecular formula C21H20N2O4S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)sulfonyl-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)propanamide.
| Compound Name | 3-(4-methoxyphenyl)sulfonyl-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)propanamide |
|---|---|
| PubChem CID | 41324224 |
| Molecular Formula | C21H20N2O4S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 3-(4-methoxyphenyl)sulfonyl-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)propanamide |
| SMILES | C#CCn1/c(=N/C(=O)CCS(=O)(=O)c2ccc(OC)cc2)sc2cc(C)ccc21 |
| InChI | InChI=1S/C21H20N2O4S2/c1-4-12-23-18-10-5-15(2)14-19(18)28-21(23)22-20(24)11-13-29(25,26)17-8-6-16(27-3)7-9-17/h1,5-10,14H,11-13H2,2-3H3/b22-21- |
| InChIKey | JFNUNDXVDLYJSG-DQRAZIAOSA-N |
| XLogP | 2.94 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|