C20H23N3O2S2 — CID 5053192
N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetamide (PubChem CID 5053192) has the molecular formula C20H23N3O2S2 and a molecular weight of 401.56 g/mol. Its IUPAC name is N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetamide.
| Compound Name | N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetamide |
|---|---|
| PubChem CID | 5053192 |
| Molecular Formula | C20H23N3O2S2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetamide |
| SMILES | C#CCn1/c(=N/C(=O)CSCC(=O)N2CCCCC2)sc2cc(C)ccc21 |
| InChI | InChI=1S/C20H23N3O2S2/c1-3-9-23-16-8-7-15(2)12-17(16)27-20(23)21-18(24)13-26-14-19(25)22-10-5-4-6-11-22/h1,7-8,12H,4-6,9-11,13-14H2,2H3/b21-20- |
| InChIKey | MKGYAHPJBITQSB-MRCUWXFGSA-N |
| XLogP | 2.82 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|