C21H26N4O6S2 — CID 4298949
ethyl 2-[2-[2-[2-(azepan-1-yl)-2-oxoethyl]sulfanylacetyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate (PubChem CID 4298949) has the molecular formula C21H26N4O6S2 and a molecular weight of 494.60 g/mol. Its IUPAC name is ethyl 2-[2-[2-[2-(azepan-1-yl)-2-oxoethyl]sulfanylacetyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[2-(azepan-1-yl)-2-oxoethyl]sulfanylacetyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4298949 |
| Molecular Formula | C21H26N4O6S2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | ethyl 2-[2-[2-[2-(azepan-1-yl)-2-oxoethyl]sulfanylacetyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)CSCC(=O)N2CCCCCC2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C21H26N4O6S2/c1-2-31-20(28)12-24-16-8-7-15(25(29)30)11-17(16)33-21(24)22-18(26)13-32-14-19(27)23-9-5-3-4-6-10-23/h7-8,11H,2-6,9-10,12-14H2,1H3/b22-21- |
| InChIKey | GRXDWBWQRQFRHY-DQRAZIAOSA-N |
| XLogP | 2.74 |
| TPSA | 124.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|