C25H27N5O8S2 — CID 4093411
ethyl 2-[6-nitro-2-[2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfonylacetyl]imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 4093411) has the molecular formula C25H27N5O8S2 and a molecular weight of 589.65 g/mol. Its IUPAC name is ethyl 2-[6-nitro-2-[2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfonylacetyl]imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[6-nitro-2-[2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfonylacetyl]imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4093411 |
| Molecular Formula | C25H27N5O8S2 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.13 |
| IUPAC Name | ethyl 2-[6-nitro-2-[2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfonylacetyl]imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)CS(=O)(=O)CC(=O)N2CCN(c3ccccc3)CC2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C25H27N5O8S2/c1-2-38-24(33)15-29-20-9-8-19(30(34)35)14-21(20)39-25(29)26-22(31)16-40(36,37)17-23(32)28-12-10-27(11-13-28)18-6-4-3-5-7-18/h3-9,14H,2,10-13,15-17H2,1H3/b26-25- |
| InChIKey | NTHXMLPOPFGIDD-QPLCGJKRSA-N |
| XLogP | 1.37 |
| TPSA | 161.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|