C20H24N4O8S2 — CID 4148681
methyl 2-[2-[2-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]sulfonylacetyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate (PubChem CID 4148681) has the molecular formula C20H24N4O8S2 and a molecular weight of 512.57 g/mol. Its IUPAC name is methyl 2-[2-[2-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]sulfonylacetyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-[2-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]sulfonylacetyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4148681 |
| Molecular Formula | C20H24N4O8S2 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | methyl 2-[2-[2-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]sulfonylacetyl]imino-6-nitro-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)CS(=O)(=O)CC(=O)N2CCCCC2C)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C20H24N4O8S2/c1-13-5-3-4-8-22(13)18(26)12-34(30,31)11-17(25)21-20-23(10-19(27)32-2)15-7-6-14(24(28)29)9-16(15)33-20/h6-7,9,13H,3-5,8,10-12H2,1-2H3/b21-20- |
| InChIKey | FVADNVGNBNVYNK-MRCUWXFGSA-N |
| XLogP | 1.03 |
| TPSA | 158.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|