C15H14N6O5S — CID 43941219
ethyl 2-[6-nitro-2-[2-(1,2,4-triazol-1-yl)acetyl]imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 43941219) has the molecular formula C15H14N6O5S and a molecular weight of 390.38 g/mol. Its IUPAC name is ethyl 2-[6-nitro-2-[2-(1,2,4-triazol-1-yl)acetyl]imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[6-nitro-2-[2-(1,2,4-triazol-1-yl)acetyl]imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 43941219 |
| Molecular Formula | C15H14N6O5S |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | ethyl 2-[6-nitro-2-[2-(1,2,4-triazol-1-yl)acetyl]imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)Cn2cncn2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C15H14N6O5S/c1-2-26-14(23)7-20-11-4-3-10(21(24)25)5-12(11)27-15(20)18-13(22)6-19-9-16-8-17-19/h3-5,8-9H,2,6-7H2,1H3/b18-15- |
| InChIKey | GAOUUWHVPHUYNN-SDXDJHTJSA-N |
| XLogP | 0.89 |
| TPSA | 134.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|