C22H29N3O3S2 — CID 4159387
2-[2-(azepan-1-yl)-2-oxoethyl]sulfanyl-N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 4159387) has the molecular formula C22H29N3O3S2 and a molecular weight of 447.63 g/mol. Its IUPAC name is 2-[2-(azepan-1-yl)-2-oxoethyl]sulfanyl-N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-[2-(azepan-1-yl)-2-oxoethyl]sulfanyl-N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 4159387 |
| Molecular Formula | C22H29N3O3S2 |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 2-[2-(azepan-1-yl)-2-oxoethyl]sulfanyl-N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | C=CCn1/c(=N/C(=O)CSCC(=O)N2CCCCCC2)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C22H29N3O3S2/c1-3-11-25-18-10-9-17(28-4-2)14-19(18)30-22(25)23-20(26)15-29-16-21(27)24-12-7-5-6-8-13-24/h3,9-10,14H,1,4-8,11-13,15-16H2,2H3/b23-22- |
| InChIKey | KOFXXOACBDFDIK-FCQUAONHSA-N |
| XLogP | 3.85 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|