C23H31N3O5S2 — CID 3335499
N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]sulfonylacetamide (PubChem CID 3335499) has the molecular formula C23H31N3O5S2 and a molecular weight of 493.65 g/mol. Its IUPAC name is N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]sulfonylacetamide.
| Compound Name | N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]sulfonylacetamide |
|---|---|
| PubChem CID | 3335499 |
| Molecular Formula | C23H31N3O5S2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]sulfonylacetamide |
| SMILES | C=CCn1/c(=N/C(=O)CS(=O)(=O)CC(=O)N2CCCCC2CC)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C23H31N3O5S2/c1-4-12-26-19-11-10-18(31-6-3)14-20(19)32-23(26)24-21(27)15-33(29,30)16-22(28)25-13-8-7-9-17(25)5-2/h4,10-11,14,17H,1,5-9,12-13,15-16H2,2-3H3/b24-23- |
| InChIKey | IVKOJOYMTXXJBO-VHXPQNKSSA-N |
| XLogP | 2.92 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|