C18H20BrN3O4S2 — CID 4142836
N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfonylacetamide (PubChem CID 4142836) has the molecular formula C18H20BrN3O4S2 and a molecular weight of 486.41 g/mol. Its IUPAC name is N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfonylacetamide.
| Compound Name | N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfonylacetamide |
|---|---|
| PubChem CID | 4142836 |
| Molecular Formula | C18H20BrN3O4S2 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 485.01 |
| IUPAC Name | N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfonylacetamide |
| SMILES | C=CCn1/c(=N/C(=O)CS(=O)(=O)CC(=O)N2CCCC2)sc2cc(Br)ccc21 |
| InChI | InChI=1S/C18H20BrN3O4S2/c1-2-7-22-14-6-5-13(19)10-15(14)27-18(22)20-16(23)11-28(25,26)12-17(24)21-8-3-4-9-21/h2,5-6,10H,1,3-4,7-9,11-12H2/b20-18- |
| InChIKey | ITZHVBNPANUBNO-ZZEZOPTASA-N |
| XLogP | 2.12 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|